5-(Chloromethyl)-3-[(methylthio)methyl]-1,2,4-oxadiazole
Catalog No: FT-0684411
CAS No: 229343-09-3
- Chemical Name: 5-(Chloromethyl)-3-[(methylthio)methyl]-1,2,4-oxadiazole
- Molecular Formula: C5H7ClN2OS
- Molecular Weight: 178.64
- InChI Key: PIGMOPKKZYRENN-UHFFFAOYSA-N
- InChI: InChI=1S/C5H7ClN2OS/c1-10-3-4-7-5(2-6)9-8-4/h2-3H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 178.64000 |
| Density: | 1.341g/cm3 |
| CAS: | 229343-09-3 |
| Bolling_Point: | 272.9ºC at 760 mmHg |
| Product_Name: | 5-(Chloromethyl)-3-[(methylthio)methyl]-1,2,4-oxadiazole |
| Melting_Point: | N/A |
| Flash_Point: | 118.8ºC |
| MF: | C5H7ClN2OS |
| Density: | 1.341g/cm3 |
|---|---|
| LogP: | 1.67140 |
| Flash_Point: | 118.8ºC |
| Refractive_Index: | 1.544 |
| FW: | 178.64000 |
| PSA: | 64.22000 |
| MF: | C5H7ClN2OS |
| Bolling_Point: | 272.9ºC at 760 mmHg |
| Vapor_Pressure: | 0.00989mmHg at 25°C |
| Exact_Mass: | 177.99700 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)